C18H11N3O4 — CID 630499
4-amino-2-(3-nitrophenyl)chromeno[3,4-c]pyridin-5-one (PubChem CID 630499) has the molecular formula C18H11N3O4 and a molecular weight of 333.30 g/mol. Its IUPAC name is 4-amino-2-(3-nitrophenyl)chromeno[3,4-c]pyridin-5-one.
| Compound Name | 4-amino-2-(3-nitrophenyl)chromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 630499 |
| Molecular Formula | C18H11N3O4 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-amino-2-(3-nitrophenyl)chromeno[3,4-c]pyridin-5-one |
| SMILES | Nc1nc(-c2cccc([N+](=O)[O-])c2)cc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C18H11N3O4/c19-17-16-13(12-6-1-2-7-15(12)25-18(16)22)9-14(20-17)10-4-3-5-11(8-10)21(23)24/h1-9H,(H2,19,20) |
| InChIKey | YPQIXDXEHWDMBN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|