C18H16N4O4S — CID 39038454
1-[[2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 39038454) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is 1-[[2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[[2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 39038454 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[[2-(4-ethylphenyl)-1,3-thiazol-4-yl]methyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | CCc1ccc(-c2nc(Cn3cc([N+](=O)[O-])cc(C(N)=O)c3=O)cs2)cc1 |
| InChI | InChI=1S/C18H16N4O4S/c1-2-11-3-5-12(6-4-11)17-20-13(10-27-17)8-21-9-14(22(25)26)7-15(16(19)23)18(21)24/h3-7,9-10H,2,8H2,1H3,(H2,19,23) |
| InChIKey | NVVFSXFFCALQFR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|