C22H25N4O2S+ — CID 9347538
2-(4-ethylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole (PubChem CID 9347538) has the molecular formula C22H25N4O2S+ and a molecular weight of 409.54 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-(4-ethylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 9347538 |
| Molecular Formula | C22H25N4O2S+ |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-(4-ethylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole |
| SMILES | CCc1ccc(-c2nc(C[NH+]3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)cc1 |
| InChI | InChI=1S/C22H24N4O2S/c1-2-17-3-5-18(6-4-17)22-23-19(16-29-22)15-24-11-13-25(14-12-24)20-7-9-21(10-8-20)26(27)28/h3-10,16H,2,11-15H2,1H3/p+1 |
| InChIKey | YGFYEUBUCALTNC-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 63.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|