C21H23N4O2S+ — CID 8590734
2-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole (PubChem CID 8590734) has the molecular formula C21H23N4O2S+ and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 8590734 |
| Molecular Formula | C21H23N4O2S+ |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1ccc(-c2nc(C[NH+]3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)cc1 |
| InChI | InChI=1S/C21H22N4O2S/c1-16-2-4-17(5-3-16)21-22-18(15-28-21)14-23-10-12-24(13-11-23)19-6-8-20(9-7-19)25(26)27/h2-9,15H,10-14H2,1H3/p+1 |
| InChIKey | RLYIRYMLNYDSAG-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 63.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|