C21H24N5O2S+ — CID 8591008
N-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 8591008) has the molecular formula C21H24N5O2S+ and a molecular weight of 410.52 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazol-2-amine.
| Compound Name | N-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8591008 |
| Molecular Formula | C21H24N5O2S+ |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-(4-methylphenyl)-4-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Nc2nc(C[NH+]3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)cc1 |
| InChI | InChI=1S/C21H23N5O2S/c1-16-2-4-17(5-3-16)22-21-23-18(15-29-21)14-24-10-12-25(13-11-24)19-6-8-20(9-7-19)26(27)28/h2-9,15H,10-14H2,1H3,(H,22,23)/p+1 |
| InChIKey | YHZRPSFRHUDPSH-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|