C12H7FN4O4 — CID 103758915
2-fluoro-5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]benzonitrile (PubChem CID 103758915) has the molecular formula C12H7FN4O4 and a molecular weight of 290.21 g/mol. Its IUPAC name is 2-fluoro-5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 103758915 |
| Molecular Formula | C12H7FN4O4 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-fluoro-5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1cc(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)ccc1F |
| InChI | InChI=1S/C12H7FN4O4/c13-9-2-1-7(3-8(9)4-14)5-16-6-10(17(20)21)11(18)15-12(16)19/h1-3,6H,5H2,(H,15,18,19) |
| InChIKey | LTVFCSCIKMBASC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 121.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|