C11H7N5O4 — CID 63812432
3-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]pyridine-2-carbonitrile (PubChem CID 63812432) has the molecular formula C11H7N5O4 and a molecular weight of 273.21 g/mol. Its IUPAC name is 3-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63812432 |
| Molecular Formula | C11H7N5O4 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 3-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1Cn1cc([N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H7N5O4/c12-4-8-7(2-1-3-13-8)5-15-6-9(16(19)20)10(17)14-11(15)18/h1-3,6H,5H2,(H,14,17,18) |
| InChIKey | HIONRIYQEYIGID-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|