C21H16F3N3O3 — CID 3314191
[[amino-[4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]phenyl]methylidene]amino] benzoate (PubChem CID 3314191) has the molecular formula C21H16F3N3O3 and a molecular weight of 415.37 g/mol. Its IUPAC name is [[amino-[4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]phenyl]methylidene]amino] benzoate.
| Compound Name | [[amino-[4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]phenyl]methylidene]amino] benzoate |
|---|---|
| PubChem CID | 3314191 |
| Molecular Formula | C21H16F3N3O3 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [[amino-[4-[[2-oxo-5-(trifluoromethyl)-1-pyridinyl]methyl]phenyl]methylidene]amino] benzoate |
| SMILES | NC(=NOC(=O)c1ccccc1)c1ccc(Cn2cc(C(F)(F)F)ccc2=O)cc1 |
| InChI | InChI=1S/C21H16F3N3O3/c22-21(23,24)17-10-11-18(28)27(13-17)12-14-6-8-15(9-7-14)19(25)26-30-20(29)16-4-2-1-3-5-16/h1-11,13H,12H2,(H2,25,26) |
| InChIKey | BXRDRJOCUQFXNJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|