C12H15F3N2O — CID 103072410
1-[2-(ethylaminomethyl)prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 103072410) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-[2-(ethylaminomethyl)prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-(ethylaminomethyl)prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 103072410 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-[2-(ethylaminomethyl)prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | C=C(CNCC)Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C12H15F3N2O/c1-3-16-6-9(2)7-17-8-10(12(13,14)15)4-5-11(17)18/h4-5,8,16H,2-3,6-7H2,1H3 |
| InChIKey | UTELBRSDLBLZDB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|