C14H19F3N2O — CID 103072411
1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 103072411) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 103072411 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | C=C(CNC(C)(C)C)Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C14H19F3N2O/c1-10(7-18-13(2,3)4)8-19-9-11(14(15,16)17)5-6-12(19)20/h5-6,9,18H,1,7-8H2,2-4H3 |
| InChIKey | ZYCNRYPRRQQUBV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|