C21H22BrNO5 — CID 42979661
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-[(2-bromophenyl)methoxy]benzoate (PubChem CID 42979661) has the molecular formula C21H22BrNO5 and a molecular weight of 448.31 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-[(2-bromophenyl)methoxy]benzoate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-[(2-bromophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 42979661 |
| Molecular Formula | C21H22BrNO5 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-[(2-bromophenyl)methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccccc1Br)NCC1CCCO1 |
| InChI | InChI=1S/C21H22BrNO5/c22-18-9-3-1-6-15(18)13-27-19-10-4-2-8-17(19)21(25)28-14-20(24)23-12-16-7-5-11-26-16/h1-4,6,8-10,16H,5,7,11-14H2,(H,23,24) |
| InChIKey | YTPHLLWZXRMNEH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |