C15H16ClNO3S — CID 4564247
[2-(2-methylpropylamino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4564247) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4564247 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CC(C)CNC(=O)COC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C15H16ClNO3S/c1-9(2)7-17-12(18)8-20-15(19)14-13(16)10-5-3-4-6-11(10)21-14/h3-6,9H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | ATGFFBGCTSUYRZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |