C17H14N2O3S2 — CID 3968436
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 3968436) has the molecular formula C17H14N2O3S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3968436 |
| Molecular Formula | C17H14N2O3S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CSc1ccc(C=CC(=O)OCC(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C17H14N2O3S2/c1-23-14-5-2-12(3-6-14)4-7-16(21)22-11-15(20)19-17-13(10-18)8-9-24-17/h2-9H,11H2,1H3,(H,19,20) |
| InChIKey | FYNONCYDHWLKSB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|