C21H18ClNO4S — CID 8835306
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 8835306) has the molecular formula C21H18ClNO4S and a molecular weight of 415.90 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8835306 |
| Molecular Formula | C21H18ClNO4S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | COc1ccccc1CNC(=O)COC(=O)/C=C/c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H18ClNO4S/c1-26-16-8-4-2-6-14(16)12-23-19(24)13-27-20(25)11-10-18-21(22)15-7-3-5-9-17(15)28-18/h2-11H,12-13H2,1H3,(H,23,24)/b11-10+ |
| InChIKey | QNOBADAFPDBCKA-ZHACJKMWSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|