C16H17ClN2O3S — CID 56557659
ethyl N-[2-[[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]amino]ethyl]carbamate (PubChem CID 56557659) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is ethyl N-[2-[[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56557659 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | ethyl N-[2-[[(E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)/C=C/c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H17ClN2O3S/c1-2-22-16(21)19-10-9-18-14(20)8-7-13-15(17)11-5-3-4-6-12(11)23-13/h3-8H,2,9-10H2,1H3,(H,18,20)(H,19,21)/b8-7+ |
| InChIKey | BKLQCICARIIYQG-BQYQJAHWSA-N |
| XLogP | 3.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|