C20H19ClN2O3S2 — CID 98915049
(E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]prop-2-enamide (PubChem CID 98915049) has the molecular formula C20H19ClN2O3S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 98915049 |
| Molecular Formula | C20H19ClN2O3S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]prop-2-enamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)/C=C/c2sc3ccccc3c2Cl)cc1C |
| InChI | InChI=1S/C20H19ClN2O3S2/c1-3-28(25,26)23-16-9-8-14(12-13(16)2)22-19(24)11-10-18-20(21)15-6-4-5-7-17(15)27-18/h4-12,23H,3H2,1-2H3,(H,22,24)/b11-10+ |
| InChIKey | IVDQTVKPXFWWPI-ZHACJKMWSA-N |
| XLogP | 5.28 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|