C20H18ClNOS — CID 7668024
(E)-3-(3-chloro-1-benzothiophen-2-yl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide (PubChem CID 7668024) has the molecular formula C20H18ClNOS and a molecular weight of 355.89 g/mol. Its IUPAC name is (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7668024 |
| Molecular Formula | C20H18ClNOS |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
| SMILES | CCc1cccc(C)c1NC(=O)/C=C/c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H18ClNOS/c1-3-14-8-6-7-13(2)20(14)22-18(23)12-11-17-19(21)15-9-4-5-10-16(15)24-17/h4-12H,3H2,1-2H3,(H,22,23)/b12-11+ |
| InChIKey | WRZANENDKOHAPI-VAWYXSNFSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|