C21H18ClNO3S — CID 7721513
[(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721513) has the molecular formula C21H18ClNO3S and a molecular weight of 399.90 g/mol. Its IUPAC name is [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721513 |
| Molecular Formula | C21H18ClNO3S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | Cc1cccc(NC(=O)[C@H](C)OC(=O)/C=C/c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C21H18ClNO3S/c1-13-6-5-7-15(12-13)23-21(25)14(2)26-19(24)11-10-18-20(22)16-8-3-4-9-17(16)27-18/h3-12,14H,1-2H3,(H,23,25)/b11-10+/t14-/m0/s1 |
| InChIKey | DBXKSMVOQXTPEY-VNDWYCCKSA-N |
| XLogP | 5.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|