C22H20ClNO3S — CID 7721503
[(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721503) has the molecular formula C22H20ClNO3S and a molecular weight of 413.93 g/mol. Its IUPAC name is [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721503 |
| Molecular Formula | C22H20ClNO3S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1sc2ccccc2c1Cl)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H20ClNO3S/c1-15(22(26)24(2)14-16-8-4-3-5-9-16)27-20(25)13-12-19-21(23)17-10-6-7-11-18(17)28-19/h3-13,15H,14H2,1-2H3/b13-12+/t15-/m0/s1 |
| InChIKey | KTMJVGZCAJTKGM-LHNRBYRGSA-N |
| XLogP | 5.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|