C21H21NO3S — CID 55426584
[1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 55426584) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55426584 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)N(C)Cc2ccccc2)sc2ccccc12 |
| InChI | InChI=1S/C21H21NO3S/c1-14-17-11-7-8-12-18(17)26-19(14)21(24)25-15(2)20(23)22(3)13-16-9-5-4-6-10-16/h4-12,15H,13H2,1-3H3 |
| InChIKey | YCIMRTQHGYZBMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |