C20H20BrNO3 — CID 8663085
[(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 8663085) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8663085 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1cccc(Br)c1)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H20BrNO3/c1-15(20(24)22(2)14-17-7-4-3-5-8-17)25-19(23)12-11-16-9-6-10-18(21)13-16/h3-13,15H,14H2,1-2H3/b12-11+/t15-/m0/s1 |
| InChIKey | DKUIAJZULFMYNY-RUMSDORHSA-N |
| XLogP | 4.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|