C21H19F4NO3 — CID 43028147
[1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 43028147) has the molecular formula C21H19F4NO3 and a molecular weight of 409.38 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 43028147 |
| Molecular Formula | C21H19F4NO3 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1cccc(C(F)(F)F)c1)C(=O)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H19F4NO3/c1-14(20(28)26(2)13-16-6-4-8-18(22)12-16)29-19(27)10-9-15-5-3-7-17(11-15)21(23,24)25/h3-12,14H,13H2,1-2H3/b10-9+ |
| InChIKey | BDKUWGGUOGCNND-MDZDMXLPSA-N |
| XLogP | 4.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|