C20H27F3O2 — CID 5375558
6-ethyloctan-3-yl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 5375558) has the molecular formula C20H27F3O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 6-ethyloctan-3-yl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | 6-ethyloctan-3-yl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 5375558 |
| Molecular Formula | C20H27F3O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 6-ethyloctan-3-yl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCC(CC)CCC(CC)OC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H27F3O2/c1-4-15(5-2)10-12-18(6-3)25-19(24)13-11-16-8-7-9-17(14-16)20(21,22)23/h7-9,11,13-15,18H,4-6,10,12H2,1-3H3/b13-11+ |
| InChIKey | IHOBPUWQMDALMF-ACCUITESSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|