C17H20F3NO3 — CID 91944220
1-morpholin-4-ylpropan-2-yl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 91944220) has the molecular formula C17H20F3NO3 and a molecular weight of 343.34 g/mol. Its IUPAC name is 1-morpholin-4-ylpropan-2-yl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | 1-morpholin-4-ylpropan-2-yl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91944220 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-morpholin-4-ylpropan-2-yl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CC(CN1CCOCC1)OC(=O)C=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3NO3/c1-13(12-21-7-9-23-10-8-21)24-16(22)6-5-14-3-2-4-15(11-14)17(18,19)20/h2-6,11,13H,7-10,12H2,1H3 |
| InChIKey | VHYJPOZLYYRHGP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|