C18H19ClN2O4S — CID 55423481
[1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 55423481) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55423481 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | CC(C)NC(=O)NC(=O)C(C)OC(=O)/C=C/c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H19ClN2O4S/c1-10(2)20-18(24)21-17(23)11(3)25-15(22)9-8-14-16(19)12-6-4-5-7-13(12)26-14/h4-11H,1-3H3,(H2,20,21,23,24)/b9-8+ |
| InChIKey | LYEZNHLPKRIBEE-CMDGGOBGSA-N |
| XLogP | 3.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|