C21H17ClO4S — CID 7721527
[(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 7721527) has the molecular formula C21H17ClO4S and a molecular weight of 400.88 g/mol. Its IUPAC name is [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7721527 |
| Molecular Formula | C21H17ClO4S |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | COc1ccc(C(=O)[C@H](C)OC(=O)/C=C/c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C21H17ClO4S/c1-13(21(24)14-7-9-15(25-2)10-8-14)26-19(23)12-11-18-20(22)16-5-3-4-6-17(16)27-18/h3-13H,1-2H3/b12-11+/t13-/m0/s1 |
| InChIKey | YDNKQWLQWBBJBA-YLSINNKHSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|