C19H14ClF2NO3S — CID 18275311
(E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]prop-2-enamide (PubChem CID 18275311) has the molecular formula C19H14ClF2NO3S and a molecular weight of 409.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18275311 |
| Molecular Formula | C19H14ClF2NO3S |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2sc3ccccc3c2Cl)cc1OC(F)F |
| InChI | InChI=1S/C19H14ClF2NO3S/c1-25-13-7-6-11(10-14(13)26-19(21)22)23-17(24)9-8-16-18(20)12-4-2-3-5-15(12)27-16/h2-10,19H,1H3,(H,23,24)/b9-8+ |
| InChIKey | IEOAGRLKVMCSSI-CMDGGOBGSA-N |
| XLogP | 5.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|