C16H16ClNO3S2 — CID 71942819
3-(3-chloro-1-benzothiophen-2-yl)-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide (PubChem CID 71942819) has the molecular formula C16H16ClNO3S2 and a molecular weight of 369.90 g/mol. Its IUPAC name is 3-(3-chloro-1-benzothiophen-2-yl)-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide.
| Compound Name | 3-(3-chloro-1-benzothiophen-2-yl)-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71942819 |
| Molecular Formula | C16H16ClNO3S2 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 3-(3-chloro-1-benzothiophen-2-yl)-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1sc2ccccc2c1Cl)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H16ClNO3S2/c17-16-12-3-1-2-4-13(12)22-14(16)5-6-15(19)18-9-11-7-8-23(20,21)10-11/h1-6,11H,7-10H2,(H,18,19) |
| InChIKey | FRXTZLYBEIRMMV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|