C17H11Cl2NO4 — CID 9487869
[2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] 2,4-dichlorobenzoate (PubChem CID 9487869) has the molecular formula C17H11Cl2NO4 and a molecular weight of 364.18 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 9487869 |
| Molecular Formula | C17H11Cl2NO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl] 2,4-dichlorobenzoate |
| SMILES | O=C1Cc2cc(C(=O)COC(=O)c3ccc(Cl)cc3Cl)ccc2N1 |
| InChI | InChI=1S/C17H11Cl2NO4/c18-11-2-3-12(13(19)7-11)17(23)24-8-15(21)9-1-4-14-10(5-9)6-16(22)20-14/h1-5,7H,6,8H2,(H,20,22) |
| InChIKey | ASHKQWWDMJCZCH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |