C16H17NO6 — CID 7704176
methyl 5-[[(Z)-(2,3-dimethoxyphenyl)methylideneamino]oxymethyl]furan-2-carboxylate (PubChem CID 7704176) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl 5-[[(Z)-(2,3-dimethoxyphenyl)methylideneamino]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(Z)-(2,3-dimethoxyphenyl)methylideneamino]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7704176 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 5-[[(Z)-(2,3-dimethoxyphenyl)methylideneamino]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CO/N=C\c2cccc(OC)c2OC)o1 |
| InChI | InChI=1S/C16H17NO6/c1-19-13-6-4-5-11(15(13)20-2)9-17-22-10-12-7-8-14(23-12)16(18)21-3/h4-9H,10H2,1-3H3/b17-9- |
| InChIKey | FRUSZPIJOKKUPV-MFOYZWKCSA-N |
| XLogP | 2.63 |
| TPSA | 79.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|