About [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate
[4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate (PubChem CID 135271656) has the molecular formula C16H23NO6
and a molecular weight of 325.36 g/mol. Its IUPAC name is [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate.
Molecular Properties
| Compound Name | [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate |
| PubChem CID | 135271656 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate |
| SMILES | COc1cc(/C=N/CCOCCO)ccc1OC(=O)[C@@H](C)OC |
| InChI | InChI=1S/C16H23NO6/c1-12(20-2)16(19)23-14-5-4-13(10-15(14)21-3)11-17-6-8-22-9-7-18/h4-5,10-12,18H,6-9H2,1-3H3/b17-11+/t12-/m1/s1 |
| InChIKey | AGYLKRCAPGAQGK-PBSOMRJOSA-N |
| XLogP | 1.06 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate?
The IUPAC name of [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate (CID 135271656) is [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate.
What is the SMILES notation for [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate?
The canonical SMILES for [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate is COc1cc(/C=N/CCOCCO)ccc1OC(=O)[C@@H](C)OC.
What is the InChIKey of [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate?
The InChIKey is AGYLKRCAPGAQGK-PBSOMRJOSA-N. The full InChI is InChI=1S/C16H23NO6/c1-12(20-2)16(19)23-14-5-4-13(10-15(14)21-3)11-17-6-8-22-9-7-18/h4-5,10-12,18H,6-9H2,1-3H3/b17-11+/t12-/m1/s1.
What are the key properties of [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate?
[4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate has a molecular weight of 325.36 g/mol, XLogP of 1.06, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2-hydroxyethoxy)ethyliminomethyl]-2-methoxyphenyl] (2R)-2-methoxypropanoate is sourced from PubChem (CID 135271656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).