C15H25N3O3 — CID 87848952
(2R)-N-(cyanomethyl)-3-cyclohexyl-2-[(2-ethoxyacetyl)amino]propanamide (PubChem CID 87848952) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2R)-N-(cyanomethyl)-3-cyclohexyl-2-[(2-ethoxyacetyl)amino]propanamide.
| Compound Name | (2R)-N-(cyanomethyl)-3-cyclohexyl-2-[(2-ethoxyacetyl)amino]propanamide |
|---|---|
| PubChem CID | 87848952 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2R)-N-(cyanomethyl)-3-cyclohexyl-2-[(2-ethoxyacetyl)amino]propanamide |
| SMILES | CCOCC(=O)N[C@H](CC1CCCCC1)C(=O)NCC#N |
| InChI | InChI=1S/C15H25N3O3/c1-2-21-11-14(19)18-13(15(20)17-9-8-16)10-12-6-4-3-5-7-12/h12-13H,2-7,9-11H2,1H3,(H,17,20)(H,18,19)/t13-/m1/s1 |
| InChIKey | JNFJMKQZEKWKIT-CYBMUJFWSA-N |
| XLogP | 1.12 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|