C26H22N6O — CID 55990533
2,5-dimethyl-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 55990533) has the molecular formula C26H22N6O and a molecular weight of 434.50 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55990533 |
| Molecular Formula | C26H22N6O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2,5-dimethyl-N-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2-c2nc(-c3ccccc3)n[nH]2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C26H22N6O/c1-17-16-21(18(2)32(17)23-14-8-9-15-27-23)26(33)28-22-13-7-6-12-20(22)25-29-24(30-31-25)19-10-4-3-5-11-19/h3-16H,1-2H3,(H,28,33)(H,29,30,31) |
| InChIKey | MDSMPZAIZQMQNZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|