C30H21N3O4 — CID 25360467
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide (PubChem CID 25360467) has the molecular formula C30H21N3O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
|---|---|
| PubChem CID | 25360467 |
| Molecular Formula | C30H21N3O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C30H21N3O4/c1-37-27-15-13-21(19-33-29(35)24-10-2-3-11-25(24)30(33)36)18-26(27)28(34)32-23-9-6-7-20(17-23)12-14-22-8-4-5-16-31-22/h2-11,13,15-18H,19H2,1H3,(H,32,34) |
| InChIKey | YRHVBVUUWSBXGB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|