C26H20N2O2 — CID 46554269
2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide (PubChem CID 46554269) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide.
| Compound Name | 2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 46554269 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
| SMILES | O=C(Cc1coc2cc3c(cc12)CCC3)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C26H20N2O2/c29-26(16-21-17-30-25-15-20-7-4-6-19(20)14-24(21)25)28-23-9-3-5-18(13-23)10-11-22-8-1-2-12-27-22/h1-3,5,8-9,12-15,17H,4,6-7,16H2,(H,28,29) |
| InChIKey | JNZZTAGZYXZRHY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|