C21H23N3O4 — CID 60511680
4-acetyl-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide (PubChem CID 60511680) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-acetyl-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60511680 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-acetyl-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc(N3C(=O)CCCC3=O)cc2)[nH]c(C)c1C(C)=O |
| InChI | InChI=1S/C21H23N3O4/c1-4-16-19(13(3)25)12(2)22-20(16)21(28)23-14-8-10-15(11-9-14)24-17(26)6-5-7-18(24)27/h8-11,22H,4-7H2,1-3H3,(H,23,28) |
| InChIKey | VAHSCAWLMOHINM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|