C22H29N3O3 — CID 55834868
methyl 2-methyl-5-[(4-piperidin-1-ylphenyl)carbamoyl]-4-propyl-1H-pyrrole-3-carboxylate (PubChem CID 55834868) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 2-methyl-5-[(4-piperidin-1-ylphenyl)carbamoyl]-4-propyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(4-piperidin-1-ylphenyl)carbamoyl]-4-propyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55834868 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | methyl 2-methyl-5-[(4-piperidin-1-ylphenyl)carbamoyl]-4-propyl-1H-pyrrole-3-carboxylate |
| SMILES | CCCc1c(C(=O)Nc2ccc(N3CCCCC3)cc2)[nH]c(C)c1C(=O)OC |
| InChI | InChI=1S/C22H29N3O3/c1-4-8-18-19(22(27)28-3)15(2)23-20(18)21(26)24-16-9-11-17(12-10-16)25-13-6-5-7-14-25/h9-12,23H,4-8,13-14H2,1-3H3,(H,24,26) |
| InChIKey | SUXBGTUGQCSYTA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|