C27H28N4O5 — CID 55706159
methyl 3-[1-[4-[[4-(2,6-dioxopiperidin-1-yl)phenyl]carbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate (PubChem CID 55706159) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is methyl 3-[1-[4-[[4-(2,6-dioxopiperidin-1-yl)phenyl]carbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[4-[[4-(2,6-dioxopiperidin-1-yl)phenyl]carbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 55706159 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | methyl 3-[1-[4-[[4-(2,6-dioxopiperidin-1-yl)phenyl]carbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)nn(-c2ccc(C(=O)Nc3ccc(N4C(=O)CCCC4=O)cc3)cc2)c1C |
| InChI | InChI=1S/C27H28N4O5/c1-17-23(15-16-26(34)36-3)18(2)31(29-17)22-11-7-19(8-12-22)27(35)28-20-9-13-21(14-10-20)30-24(32)5-4-6-25(30)33/h7-14H,4-6,15-16H2,1-3H3,(H,28,35) |
| InChIKey | PJTHGWORYZVYTM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|