C27H31N3O4 — CID 55902895
methyl 3-[1-[4-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylcarbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate (PubChem CID 55902895) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 3-[1-[4-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylcarbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[4-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylcarbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 55902895 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | methyl 3-[1-[4-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylcarbamoyl]phenyl]-3,5-dimethylpyrazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)nn(-c2ccc(C(=O)NCCOc3ccc4c(c3)CCC4)cc2)c1C |
| InChI | InChI=1S/C27H31N3O4/c1-18-25(13-14-26(31)33-3)19(2)30(29-18)23-10-7-21(8-11-23)27(32)28-15-16-34-24-12-9-20-5-4-6-22(20)17-24/h7-12,17H,4-6,13-16H2,1-3H3,(H,28,32) |
| InChIKey | CJVSGDUKZAAGLX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|