C20H18N2O4 — CID 94801265
(2R)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 94801265) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (2R)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 94801265 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2R)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2C(=O)CCCC2=O)cc1)[C@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C20H18N2O4/c23-18-6-3-7-19(24)22(18)15-10-8-14(9-11-15)21-20(25)17-12-13-4-1-2-5-16(13)26-17/h1-2,4-5,8-11,17H,3,6-7,12H2,(H,21,25)/t17-/m1/s1 |
| InChIKey | WHLGOWWDBJVQGL-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|