C30H27N3O4S — CID 28637305
2-[benzenesulfonyl(benzyl)amino]-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 28637305) has the molecular formula C30H27N3O4S and a molecular weight of 525.63 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 28637305 |
| Molecular Formula | C30H27N3O4S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2=O)cc1)c1ccccc1N(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H27N3O4S/c34-29-16-9-21-32(29)25-19-17-24(18-20-25)31-30(35)27-14-7-8-15-28(27)33(22-23-10-3-1-4-11-23)38(36,37)26-12-5-2-6-13-26/h1-8,10-15,17-20H,9,16,21-22H2,(H,31,35) |
| InChIKey | GHEQDBKTCFEZIC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |