C25H29N3O3S — CID 55702473
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide (PubChem CID 55702473) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55702473 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,5-dimethyl-1-(3-propan-2-ylphenyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3CCCS3(=O)=O)cc2)c(C)n1-c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C25H29N3O3S/c1-17(2)20-7-5-8-23(16-20)28-18(3)15-24(19(28)4)25(29)26-21-9-11-22(12-10-21)27-13-6-14-32(27,30)31/h5,7-12,15-17H,6,13-14H2,1-4H3,(H,26,29) |
| InChIKey | GJWVMJGXVLUWOB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|