C16H22FIN2O — CID 47040952
4-fluoro-2-iodo-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 47040952) has the molecular formula C16H22FIN2O and a molecular weight of 404.27 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 4-fluoro-2-iodo-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 47040952 |
| Molecular Formula | C16H22FIN2O |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-fluoro-2-iodo-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | CC1CCCCN1CCCNC(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C16H22FIN2O/c1-12-5-2-3-9-20(12)10-4-8-19-16(21)14-7-6-13(17)11-15(14)18/h6-7,11-12H,2-5,8-10H2,1H3,(H,19,21) |
| InChIKey | MYGOHTAMGUDKMN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|