C20H16FN5OS — CID 53123571
1-(4-fluorophenyl)-5-pyridin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide (PubChem CID 53123571) has the molecular formula C20H16FN5OS and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-pyridin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-pyridin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 53123571 |
| Molecular Formula | C20H16FN5OS |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-(4-fluorophenyl)-5-pyridin-4-yl-N-(2-thiophen-2-ylethyl)triazole-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1nnn(-c2ccc(F)cc2)c1-c1ccncc1 |
| InChI | InChI=1S/C20H16FN5OS/c21-15-3-5-16(6-4-15)26-19(14-7-10-22-11-8-14)18(24-25-26)20(27)23-12-9-17-2-1-13-28-17/h1-8,10-11,13H,9,12H2,(H,23,27) |
| InChIKey | HQFURORYAVVGCU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |