C19H29ClN6O3 — CID 119445229
2-[4-(2-methoxyethoxy)phenyl]-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119445229) has the molecular formula C19H29ClN6O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)phenyl]-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 2-[4-(2-methoxyethoxy)phenyl]-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119445229 |
| Molecular Formula | C19H29ClN6O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)phenyl]-5-methyl-N-(2-piperazin-1-ylethyl)triazole-4-carboxamide;hydrochloride |
| SMILES | COCCOc1ccc(-n2nc(C)c(C(=O)NCCN3CCNCC3)n2)cc1.Cl |
| InChI | InChI=1S/C19H28N6O3.ClH/c1-15-18(19(26)21-9-12-24-10-7-20-8-11-24)23-25(22-15)16-3-5-17(6-4-16)28-14-13-27-2;/h3-6,20H,7-14H2,1-2H3,(H,21,26);1H |
| InChIKey | PVBAYAUWMHOAIA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|