C18H30ClN3O3 — CID 119445383
4-(4-ethoxyphenoxy)-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride (PubChem CID 119445383) has the molecular formula C18H30ClN3O3 and a molecular weight of 371.91 g/mol. Its IUPAC name is 4-(4-ethoxyphenoxy)-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride.
| Compound Name | 4-(4-ethoxyphenoxy)-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119445383 |
| Molecular Formula | C18H30ClN3O3 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 4-(4-ethoxyphenoxy)-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride |
| SMILES | CCOc1ccc(OCCCC(=O)NCCN2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C18H29N3O3.ClH/c1-2-23-16-5-7-17(8-6-16)24-15-3-4-18(22)20-11-14-21-12-9-19-10-13-21;/h5-8,19H,2-4,9-15H2,1H3,(H,20,22);1H |
| InChIKey | JEXDCNOAAFEESL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|