C18H28ClN3O3 — CID 119448841
4-(4-ethoxyphenyl)-4-oxo-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride (PubChem CID 119448841) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-4-oxo-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride.
| Compound Name | 4-(4-ethoxyphenyl)-4-oxo-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119448841 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 4-(4-ethoxyphenyl)-4-oxo-N-(2-piperazin-1-ylethyl)butanamide;hydrochloride |
| SMILES | CCOc1ccc(C(=O)CCC(=O)NCCN2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C18H27N3O3.ClH/c1-2-24-16-5-3-15(4-6-16)17(22)7-8-18(23)20-11-14-21-12-9-19-10-13-21;/h3-6,19H,2,7-14H2,1H3,(H,20,23);1H |
| InChIKey | PHVQGQJMBUBPBI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |