C19H21N5O3 — CID 120520073
3-[(5-methyl-1-quinolin-6-yltriazole-4-carbonyl)-propan-2-ylamino]propanoic acid (PubChem CID 120520073) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-[(5-methyl-1-quinolin-6-yltriazole-4-carbonyl)-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[(5-methyl-1-quinolin-6-yltriazole-4-carbonyl)-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 120520073 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-[(5-methyl-1-quinolin-6-yltriazole-4-carbonyl)-propan-2-ylamino]propanoic acid |
| SMILES | Cc1c(C(=O)N(CCC(=O)O)C(C)C)nnn1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H21N5O3/c1-12(2)23(10-8-17(25)26)19(27)18-13(3)24(22-21-18)15-6-7-16-14(11-15)5-4-9-20-16/h4-7,9,11-12H,8,10H2,1-3H3,(H,25,26) |
| InChIKey | UVUVBNXRBAVCEM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |