C20H19F2N5O4 — CID 55672725
N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 55672725) has the molecular formula C20H19F2N5O4 and a molecular weight of 431.40 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55672725 |
| Molecular Formula | C20H19F2N5O4 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | CCC(NC(=O)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C)c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H19F2N5O4/c1-3-16(15-9-4-5-10-17(15)31-20(21)22)23-19(28)18-12(2)26(25-24-18)13-7-6-8-14(11-13)27(29)30/h4-11,16,20H,3H2,1-2H3,(H,23,28) |
| InChIKey | FTGAGIQQTIKWDP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|