C24H28N6O5 — CID 55972232
tert-butyl N-ethyl-N-[[2-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]methyl]carbamate (PubChem CID 55972232) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[[2-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[[2-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 55972232 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | tert-butyl N-ethyl-N-[[2-[[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]amino]phenyl]methyl]carbamate |
| SMILES | CCN(Cc1ccccc1NC(=O)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28N6O5/c1-6-28(23(32)35-24(3,4)5)15-17-10-7-8-13-20(17)25-22(31)21-16(2)29(27-26-21)18-11-9-12-19(14-18)30(33)34/h7-14H,6,15H2,1-5H3,(H,25,31) |
| InChIKey | UGTNNYILJZVPLT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|